C14H13Cl2N3O3 — CID 4919605
4-[4-[(3,4-dichlorobenzoyl)amino]pyrazol-1-yl]butanoic acid (PubChem CID 4919605) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-[4-[(3,4-dichlorobenzoyl)amino]pyrazol-1-yl]butanoic acid.
| Compound Name | 4-[4-[(3,4-dichlorobenzoyl)amino]pyrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 4919605 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-[4-[(3,4-dichlorobenzoyl)amino]pyrazol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(NC(=O)c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C14H13Cl2N3O3/c15-11-4-3-9(6-12(11)16)14(22)18-10-7-17-19(8-10)5-1-2-13(20)21/h3-4,6-8H,1-2,5H2,(H,18,22)(H,20,21) |
| InChIKey | SBVXOYPHCONKDB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |