About N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine
N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine (PubChem CID 4920299) has the molecular formula C6H9N7
and a molecular weight of 179.19 g/mol. Its IUPAC name is N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine |
| PubChem CID | 4920299 |
| Molecular Formula | C6H9N7 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine |
| SMILES | NCCNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C6H9N7/c7-3-4-8-5-1-2-6-9-11-12-13(6)10-5/h1-2H,3-4,7H2,(H,8,10) |
| InChIKey | MABBJPHFTWCQBC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine?
The IUPAC name of N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine (CID 4920299) is N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine is NCCNc1ccc2nnnn2n1.
What is the InChIKey of N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine?
The InChIKey is MABBJPHFTWCQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N7/c7-3-4-8-5-1-2-6-9-11-12-13(6)10-5/h1-2H,3-4,7H2,(H,8,10).
What are the key properties of N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine?
N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine has a molecular weight of 179.19 g/mol, XLogP of -1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(tetrazolo[1,5-b]pyridazin-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 4920299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).