C19H15NO3 — CID 4920416
1,4-diphenyl-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione (PubChem CID 4920416) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1,4-diphenyl-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione.
| Compound Name | 1,4-diphenyl-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 4920416 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1,4-diphenyl-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
| SMILES | O=C1OCC2=C1C(c1ccccc1)CC(=O)N2c1ccccc1 |
| InChI | InChI=1S/C19H15NO3/c21-17-11-15(13-7-3-1-4-8-13)18-16(12-23-19(18)22)20(17)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | SODYPYQMKKIOKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |