C19H13FN2O5 — CID 4920417
1-(4-fluorophenyl)-4-(3-nitrophenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione (PubChem CID 4920417) has the molecular formula C19H13FN2O5 and a molecular weight of 368.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(3-nitrophenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione.
| Compound Name | 1-(4-fluorophenyl)-4-(3-nitrophenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 4920417 |
| Molecular Formula | C19H13FN2O5 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(3-nitrophenyl)-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
| SMILES | O=C1OCC2=C1C(c1cccc([N+](=O)[O-])c1)CC(=O)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13FN2O5/c20-12-4-6-13(7-5-12)21-16-10-27-19(24)18(16)15(9-17(21)23)11-2-1-3-14(8-11)22(25)26/h1-8,15H,9-10H2 |
| InChIKey | YHVWQFHEMXHAJA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|