About 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one
3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one (PubChem CID 4920828) has the molecular formula C20H21NO5
and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one |
| PubChem CID | 4920828 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one |
| SMILES | COCCn1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)oc1=O |
| InChI | InChI=1S/C20H21NO5/c1-23-13-12-21-18(14-4-8-16(24-2)9-5-14)19(26-20(21)22)15-6-10-17(25-3)11-7-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | YIWBQKYNRJOGQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one?
The IUPAC name of 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one (CID 4920828) is 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one.
What is the SMILES notation for 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one?
The canonical SMILES for 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one is COCCn1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)oc1=O.
What is the InChIKey of 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one?
The InChIKey is YIWBQKYNRJOGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO5/c1-23-13-12-21-18(14-4-8-16(24-2)9-5-14)19(26-20(21)22)15-6-10-17(25-3)11-7-15/h4-11H,12-13H2,1-3H3.
What are the key properties of 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one?
3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one has a molecular weight of 355.39 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethyl)-4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-one is sourced from PubChem (CID 4920828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).