About 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine
1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine (PubChem CID 4920926) has the molecular formula C21H28N2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine |
| PubChem CID | 4920926 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1c(C23CC4CC(CC(C4)C2)C3)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H28N2/c1-23(2)13-18-17-5-3-4-6-19(17)22-20(18)21-10-14-7-15(11-21)9-16(8-14)12-21/h3-6,14-16,22H,7-13H2,1-2H3 |
| InChIKey | OMMBISNTQNZMFG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine (CID 4920926) is 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine is CN(C)Cc1c(C23CC4CC(CC(C4)C2)C3)[nH]c2ccccc12.
What is the InChIKey of 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine?
The InChIKey is OMMBISNTQNZMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2/c1-23(2)13-18-17-5-3-4-6-19(17)22-20(18)21-10-14-7-15(11-21)9-16(8-14)12-21/h3-6,14-16,22H,7-13H2,1-2H3.
What are the key properties of 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine?
1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine has a molecular weight of 308.47 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-adamantyl)-1H-indol-3-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 4920926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).