C32H28BrNO4 — CID 4921787
7-bromo-1-(2,2-dimethylpropanoyl)-2-(3-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 4921787) has the molecular formula C32H28BrNO4 and a molecular weight of 570.48 g/mol. Its IUPAC name is 7-bromo-1-(2,2-dimethylpropanoyl)-2-(3-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 7-bromo-1-(2,2-dimethylpropanoyl)-2-(3-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 4921787 |
| Molecular Formula | C32H28BrNO4 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 7-bromo-1-(2,2-dimethylpropanoyl)-2-(3-methoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1cccc(C2C(C(=O)C(C)(C)C)N3c4ccc(Br)cc4C=CC3C23C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C32H28BrNO4/c1-31(2,3)30(37)27-26(19-8-7-9-21(17-19)38-4)32(28(35)22-10-5-6-11-23(22)29(32)36)25-15-12-18-16-20(33)13-14-24(18)34(25)27/h5-17,25-27H,1-4H3 |
| InChIKey | DLRFSSBCWRIZHJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|