About 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one
2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 4922032) has the molecular formula C34H33ClN2O3
and a molecular weight of 553.10 g/mol. Its IUPAC name is 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 4922032 |
| Molecular Formula | C34H33ClN2O3 |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(Cl)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C34H33ClN2O3/c1-3-5-18-37(19-6-4-2)24-16-17-27-31(20-24)39-32-22-29(35)30(36-23-12-8-7-9-13-23)21-28(32)34(27)26-15-11-10-14-25(26)33(38)40-34/h7-17,20-22,36H,3-6,18-19H2,1-2H3 |
| InChIKey | VCPPDRRBGAGHFT-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (CID 4922032) is 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one is CCCCN(CCCC)c1ccc2c(c1)Oc1cc(Cl)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21.
What is the InChIKey of 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is VCPPDRRBGAGHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H33ClN2O3/c1-3-5-18-37(19-6-4-2)24-16-17-27-31(20-24)39-32-22-29(35)30(36-23-12-8-7-9-13-23)21-28(32)34(27)26-15-11-10-14-25(26)33(38)40-34/h7-17,20-22,36H,3-6,18-19H2,1-2H3.
What are the key properties of 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one?
2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 553.10 g/mol, XLogP of 9.06, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-anilino-3'-chloro-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 4922032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).