C12H20N2O — CID 49224332
1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl(cyclopropyl)methanone (PubChem CID 49224332) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl(cyclopropyl)methanone.
| Compound Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl(cyclopropyl)methanone |
|---|---|
| PubChem CID | 49224332 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl(cyclopropyl)methanone |
| SMILES | O=C(C1CC1)N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C12H20N2O/c15-12(10-4-5-10)14-8-2-7-13-6-1-3-11(13)9-14/h10-11H,1-9H2 |
| InChIKey | WSVNWKGVHKBQJK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |