C24H34N4O2 — CID 49230064
N-(3-ethoxypropyl)-1-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]piperidine-4-carboxamide (PubChem CID 49230064) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 49230064 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | N-(3-ethoxypropyl)-1-[(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(Cc2nn(-c3ccccc3)c3c2CCC3)CC1 |
| InChI | InChI=1S/C24H34N4O2/c1-2-30-17-7-14-25-24(29)19-12-15-27(16-13-19)18-22-21-10-6-11-23(21)28(26-22)20-8-4-3-5-9-20/h3-5,8-9,19H,2,6-7,10-18H2,1H3,(H,25,29) |
| InChIKey | FPAAGQSOPPGDHL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|