C16H22F2N2S — CID 49234490
2-[[2-(difluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 49234490) has the molecular formula C16H22F2N2S and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[[2-(difluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-[[2-(difluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 49234490 |
| Molecular Formula | C16H22F2N2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[[2-(difluoromethylsulfanyl)phenyl]methyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | FC(F)Sc1ccccc1CN1CCCN2CCCC2C1 |
| InChI | InChI=1S/C16H22F2N2S/c17-16(18)21-15-7-2-1-5-13(15)11-19-8-4-10-20-9-3-6-14(20)12-19/h1-2,5,7,14,16H,3-4,6,8-12H2 |
| InChIKey | WIDWDKBBZYOUKT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |