C19H24N2O6S — CID 49245676
4-[(4-ethoxy-3,5-dimethoxyphenyl)methylsulfamoyl]-N-methylbenzamide (PubChem CID 49245676) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylsulfamoyl]-N-methylbenzamide.
| Compound Name | 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylsulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 49245676 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylsulfamoyl]-N-methylbenzamide |
| SMILES | CCOc1c(OC)cc(CNS(=O)(=O)c2ccc(C(=O)NC)cc2)cc1OC |
| InChI | InChI=1S/C19H24N2O6S/c1-5-27-18-16(25-3)10-13(11-17(18)26-4)12-21-28(23,24)15-8-6-14(7-9-15)19(22)20-2/h6-11,21H,5,12H2,1-4H3,(H,20,22) |
| InChIKey | TUQFCOYCLCMEIH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |