C21H24ClN3O4 — CID 4925197
N-[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-methylpropanamide (PubChem CID 4925197) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 4925197 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[4-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-methylpropanamide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)c2ccc(NC(=O)C(C)C)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C21H24ClN3O4/c1-12(2)20(27)23-16-7-5-15(6-8-16)21(28)25-24-18(26)11-29-17-9-13(3)19(22)14(4)10-17/h5-10,12H,11H2,1-4H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | SNFZHTPRMMTYSD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|