C16H20N4O5 — CID 4925375
N-[2-[2-(2-nitrobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 4925375) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[2-[2-(2-nitrobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-(2-nitrobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4925375 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[2-[2-(2-nitrobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O5/c21-14(10-17-15(22)11-6-2-1-3-7-11)18-19-16(23)12-8-4-5-9-13(12)20(24)25/h4-5,8-9,11H,1-3,6-7,10H2,(H,17,22)(H,18,21)(H,19,23) |
| InChIKey | FRVLEHNJINJNPC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|