C19H27N3O4 — CID 4925440
N-[2-[2-[2-(2,5-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 4925440) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[2-[2-[2-(2,5-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-[2-(2,5-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4925440 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[2-[2-[2-(2,5-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)CNC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-13-8-9-14(2)16(10-13)26-12-18(24)22-21-17(23)11-20-19(25)15-6-4-3-5-7-15/h8-10,15H,3-7,11-12H2,1-2H3,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | IQPNQOXHYONMJL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|