C26H26N2O5 — CID 4927289
propyl 4-[2-oxo-2-[2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]ethoxy]benzoate (PubChem CID 4927289) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is propyl 4-[2-oxo-2-[2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]ethoxy]benzoate.
| Compound Name | propyl 4-[2-oxo-2-[2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]ethoxy]benzoate |
|---|---|
| PubChem CID | 4927289 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | propyl 4-[2-oxo-2-[2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]ethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NN=Cc2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2O5/c1-2-16-31-26(30)21-12-14-23(15-13-21)32-19-25(29)28-27-17-22-10-6-7-11-24(22)33-18-20-8-4-3-5-9-20/h3-15,17H,2,16,18-19H2,1H3,(H,28,29) |
| InChIKey | NJNPUCYYMHWCSF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|