C20H23N3O4 — CID 4927512
propyl 4-[2-[2-[1-(3-aminophenyl)ethylidene]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 4927512) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is propyl 4-[2-[2-[1-(3-aminophenyl)ethylidene]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | propyl 4-[2-[2-[1-(3-aminophenyl)ethylidene]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 4927512 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | propyl 4-[2-[2-[1-(3-aminophenyl)ethylidene]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCCOC(=O)c1ccc(OCC(=O)NN=C(C)c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-11-26-20(25)15-7-9-18(10-8-15)27-13-19(24)23-22-14(2)16-5-4-6-17(21)12-16/h4-10,12H,3,11,13,21H2,1-2H3,(H,23,24) |
| InChIKey | ZZGVSYSBDPIRHN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|