C24H26N2O4S — CID 4928885
N-[4-(benzylsulfamoyl)phenyl]-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 4928885) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-(benzylsulfamoyl)phenyl]-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[4-(benzylsulfamoyl)phenyl]-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 4928885 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-(benzylsulfamoyl)phenyl]-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-18(2)20-8-12-22(13-9-20)30-17-24(27)26-21-10-14-23(15-11-21)31(28,29)25-16-19-6-4-3-5-7-19/h3-15,18,25H,16-17H2,1-2H3,(H,26,27) |
| InChIKey | QCAGSCLCZAASDP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |