C34H36N2O5 — CID 4929418
2-(3-methylphenoxy)-N-[4-[4-[2-(3-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide (PubChem CID 4929418) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-[4-[4-[2-(3-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide.
| Compound Name | 2-(3-methylphenoxy)-N-[4-[4-[2-(3-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 4929418 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-(3-methylphenoxy)-N-[4-[4-[2-(3-methylphenoxy)butanoylamino]phenoxy]phenyl]butanamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1ccc(Oc2ccc(NC(=O)C(CC)Oc3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O5/c1-5-31(40-29-11-7-9-23(3)21-29)33(37)35-25-13-17-27(18-14-25)39-28-19-15-26(16-20-28)36-34(38)32(6-2)41-30-12-8-10-24(4)22-30/h7-22,31-32H,5-6H2,1-4H3,(H,35,37)(H,36,38) |
| InChIKey | COSMCHASSGBADB-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |