C22H21N3O7S — CID 4931088
N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)acetamide (PubChem CID 4931088) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4931088 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-(2-nitrophenoxy)acetamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)COc3ccccc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H21N3O7S/c1-2-31-18-11-7-17(8-12-18)24-33(29,30)19-13-9-16(10-14-19)23-22(26)15-32-21-6-4-3-5-20(21)25(27)28/h3-14,24H,2,15H2,1H3,(H,23,26) |
| InChIKey | ODXJQJAECGWLFG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|