C16H12ClN3O2S2 — CID 49319838
(E)-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 49319838) has the molecular formula C16H12ClN3O2S2 and a molecular weight of 377.88 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 49319838 |
| Molecular Formula | C16H12ClN3O2S2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3cscn3)n2)cc1Cl |
| InChI | InChI=1S/C16H12ClN3O2S2/c1-22-14-4-2-10(6-12(14)17)13-8-24-16(19-13)20-15(21)5-3-11-7-23-9-18-11/h2-9H,1H3,(H,19,20,21)/b5-3+ |
| InChIKey | XQGFWRLKFOZASQ-HWKANZROSA-N |
| XLogP | 4.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|