C20H19F2N3O3 — CID 49337556
N-[[3-(difluoromethoxy)phenyl]methyl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide (PubChem CID 49337556) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 49337556 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-4-oxo-3-propan-2-ylphthalazine-1-carboxamide |
| SMILES | CC(C)n1nc(C(=O)NCc2cccc(OC(F)F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H19F2N3O3/c1-12(2)25-19(27)16-9-4-3-8-15(16)17(24-25)18(26)23-11-13-6-5-7-14(10-13)28-20(21)22/h3-10,12,20H,11H2,1-2H3,(H,23,26) |
| InChIKey | WFBHQKDDUICZGQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |