C20H23N3O5S — CID 4935632
N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-pentoxybenzamide (PubChem CID 4935632) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-pentoxybenzamide.
| Compound Name | N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 4935632 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[(2-methoxy-5-nitrophenyl)carbamothioyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)Nc2cc([N+](=O)[O-])ccc2OC)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-4-5-12-28-16-9-6-14(7-10-16)19(24)22-20(29)21-17-13-15(23(25)26)8-11-18(17)27-2/h6-11,13H,3-5,12H2,1-2H3,(H2,21,22,24,29) |
| InChIKey | RBUGNIGDGRWEAO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|