About benzyl N-benzylcarbamate
benzyl N-benzylcarbamate (PubChem CID 4935691) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is benzyl N-benzylcarbamate.
Molecular Properties
| Compound Name | benzyl N-benzylcarbamate |
| PubChem CID | 4935691 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | benzyl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c17-15(16-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17) |
| InChIKey | ILKFHZRKLTWFKR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-benzylcarbamate?
The IUPAC name of benzyl N-benzylcarbamate (CID 4935691) is benzyl N-benzylcarbamate.
What is the SMILES notation for benzyl N-benzylcarbamate?
The canonical SMILES for benzyl N-benzylcarbamate is O=C(NCc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl N-benzylcarbamate?
The InChIKey is ILKFHZRKLTWFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c17-15(16-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17).
What are the key properties of benzyl N-benzylcarbamate?
benzyl N-benzylcarbamate has a molecular weight of 241.29 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-benzylcarbamate is sourced from PubChem (CID 4935691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).