About 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide
6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide (PubChem CID 49357013) has the molecular formula C11H11N3O2S
and a molecular weight of 249.30 g/mol. Its IUPAC name is 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide |
| PubChem CID | 49357013 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1nccs1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C11H11N3O2S/c15-9-2-1-8(7-14-9)11(16)13-4-3-10-12-5-6-17-10/h1-2,5-7H,3-4H2,(H,13,16)(H,14,15) |
| InChIKey | MDMVQEGBSJSTQD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide?
The IUPAC name of 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide (CID 49357013) is 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide.
What is the SMILES notation for 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide?
The canonical SMILES for 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide is O=C(NCCc1nccs1)c1ccc(=O)[nH]c1.
What is the InChIKey of 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide?
The InChIKey is MDMVQEGBSJSTQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S/c15-9-2-1-8(7-14-9)11(16)13-4-3-10-12-5-6-17-10/h1-2,5-7H,3-4H2,(H,13,16)(H,14,15).
What are the key properties of 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide?
6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide has a molecular weight of 249.30 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyridine-3-carboxamide is sourced from PubChem (CID 49357013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).