C21H30N2O3 — CID 49374332
4-phenylmethoxy-1-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one (PubChem CID 49374332) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-phenylmethoxy-1-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-phenylmethoxy-1-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 49374332 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-phenylmethoxy-1-[4-(pyrrolidine-1-carbonyl)piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCOCc1ccccc1)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H30N2O3/c24-20(9-6-16-26-17-18-7-2-1-3-8-18)22-14-10-19(11-15-22)21(25)23-12-4-5-13-23/h1-3,7-8,19H,4-6,9-17H2 |
| InChIKey | NGJFIAXKEAULCU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|