C18H24N2O3 — CID 49377141
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-4-phenylmethoxybutanamide (PubChem CID 49377141) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-4-phenylmethoxybutanamide.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-4-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 49377141 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-methyl-4-phenylmethoxybutanamide |
| SMILES | Cc1noc(C)c1CN(C)C(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O3/c1-14-17(15(2)23-19-14)12-20(3)18(21)10-7-11-22-13-16-8-5-4-6-9-16/h4-6,8-9H,7,10-13H2,1-3H3 |
| InChIKey | AUPBTZDJAJLKQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|