C16H22F3NO3 — CID 49387025
4-phenylmethoxy-N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]butanamide (PubChem CID 49387025) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-phenylmethoxy-N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]butanamide.
| Compound Name | 4-phenylmethoxy-N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 49387025 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-phenylmethoxy-N-[1-(2,2,2-trifluoroethoxy)propan-2-yl]butanamide |
| SMILES | CC(COCC(F)(F)F)NC(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C16H22F3NO3/c1-13(10-23-12-16(17,18)19)20-15(21)8-5-9-22-11-14-6-3-2-4-7-14/h2-4,6-7,13H,5,8-12H2,1H3,(H,20,21) |
| InChIKey | DZOQATAWZZXXLB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|