About oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate
oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4941144) has the molecular formula C21H24FN3O5S
and a molecular weight of 449.50 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| PubChem CID | 4941144 |
| Molecular Formula | C21H24FN3O5S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(C=Cc1ccc(F)cc1)NC(=S)N1CCNC(=O)C1CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C21H24FN3O5S/c22-15-6-3-14(4-7-15)5-8-18(26)24-21(31)25-10-9-23-20(28)17(25)12-19(27)30-13-16-2-1-11-29-16/h3-8,16-17H,1-2,9-13H2,(H,23,28)(H,24,26,31) |
| InChIKey | SRWQWKOKNZPLTG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate?
The IUPAC name of oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (CID 4941144) is oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
What is the SMILES notation for oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate?
The canonical SMILES for oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate is O=C(C=Cc1ccc(F)cc1)NC(=S)N1CCNC(=O)C1CC(=O)OCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate?
The InChIKey is SRWQWKOKNZPLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FN3O5S/c22-15-6-3-14(4-7-15)5-8-18(26)24-21(31)25-10-9-23-20(28)17(25)12-19(27)30-13-16-2-1-11-29-16/h3-8,16-17H,1-2,9-13H2,(H,23,28)(H,24,26,31).
What are the key properties of oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate?
oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate has a molecular weight of 449.50 g/mol, XLogP of 1.15, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl 2-[1-[3-(4-fluorophenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate is sourced from PubChem (CID 4941144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).