C35H38N2O4 — CID 4941899
2-butoxy-N-[4-[[4-[(2-butoxybenzoyl)amino]phenyl]methyl]phenyl]benzamide (PubChem CID 4941899) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-butoxy-N-[4-[[4-[(2-butoxybenzoyl)amino]phenyl]methyl]phenyl]benzamide.
| Compound Name | 2-butoxy-N-[4-[[4-[(2-butoxybenzoyl)amino]phenyl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4941899 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 2-butoxy-N-[4-[[4-[(2-butoxybenzoyl)amino]phenyl]methyl]phenyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)Nc1ccc(Cc2ccc(NC(=O)c3ccccc3OCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O4/c1-3-5-23-40-32-13-9-7-11-30(32)34(38)36-28-19-15-26(16-20-28)25-27-17-21-29(22-18-27)37-35(39)31-12-8-10-14-33(31)41-24-6-4-2/h7-22H,3-6,23-25H2,1-2H3,(H,36,38)(H,37,39) |
| InChIKey | JRMPYRUWPAHLQJ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|