C18H18F3N3O3S — CID 49430103
pyridin-4-yl-[4-[2-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]methanone (PubChem CID 49430103) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is pyridin-4-yl-[4-[2-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]methanone.
| Compound Name | pyridin-4-yl-[4-[2-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 49430103 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | pyridin-4-yl-[4-[2-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCC(Nc2ccccc2S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H18F3N3O3S/c19-18(20,21)28(26,27)16-4-2-1-3-15(16)23-14-7-11-24(12-8-14)17(25)13-5-9-22-10-6-13/h1-6,9-10,14,23H,7-8,11-12H2 |
| InChIKey | YIPVKBLWMWISBF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |