About 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine
1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 49430854) has the molecular formula C10H10N6S
and a molecular weight of 246.30 g/mol. Its IUPAC name is 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 49430854 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCc3cscn3)ncnc21 |
| InChI | InChI=1S/C10H10N6S/c1-16-10-8(3-15-16)9(12-5-13-10)11-2-7-4-17-6-14-7/h3-6H,2H2,1H3,(H,11,12,13) |
| InChIKey | KHHZHKYLYSZHBQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine (CID 49430854) is 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine is Cn1ncc2c(NCc3cscn3)ncnc21.
What is the InChIKey of 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is KHHZHKYLYSZHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6S/c1-16-10-8(3-15-16)9(12-5-13-10)11-2-7-4-17-6-14-7/h3-6H,2H2,1H3,(H,11,12,13).
What are the key properties of 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine?
1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 246.30 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(1,3-thiazol-4-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 49430854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).