C20H24FN5OS — CID 49431572
N-butyl-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-3-carboxamide (PubChem CID 49431572) has the molecular formula C20H24FN5OS and a molecular weight of 401.51 g/mol. Its IUPAC name is N-butyl-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | N-butyl-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49431572 |
| Molecular Formula | C20H24FN5OS |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-butyl-1-[6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2nn3cc(-c4ccc(F)cc4)nc3s2)C1 |
| InChI | InChI=1S/C20H24FN5OS/c1-2-3-10-22-18(27)15-5-4-11-25(12-15)20-24-26-13-17(23-19(26)28-20)14-6-8-16(21)9-7-14/h6-9,13,15H,2-5,10-12H2,1H3,(H,22,27) |
| InChIKey | BRZSNZDPIDPSOI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|