C19H24N4O3 — CID 49431600
N-butyl-1-(5-nitroquinolin-8-yl)piperidine-3-carboxamide (PubChem CID 49431600) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-butyl-1-(5-nitroquinolin-8-yl)piperidine-3-carboxamide.
| Compound Name | N-butyl-1-(5-nitroquinolin-8-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49431600 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-butyl-1-(5-nitroquinolin-8-yl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2ccc([N+](=O)[O-])c3cccnc23)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-2-3-10-21-19(24)14-6-5-12-22(13-14)17-9-8-16(23(25)26)15-7-4-11-20-18(15)17/h4,7-9,11,14H,2-3,5-6,10,12-13H2,1H3,(H,21,24) |
| InChIKey | DZECYUZDXPNDDG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|