C16H14N4O7 — CID 4944143
2-nitro-N'-[2-(2-nitrophenoxy)propanoyl]benzohydrazide (PubChem CID 4944143) has the molecular formula C16H14N4O7 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-nitro-N'-[2-(2-nitrophenoxy)propanoyl]benzohydrazide.
| Compound Name | 2-nitro-N'-[2-(2-nitrophenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 4944143 |
| Molecular Formula | C16H14N4O7 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-nitro-N'-[2-(2-nitrophenoxy)propanoyl]benzohydrazide |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O7/c1-10(27-14-9-5-4-8-13(14)20(25)26)15(21)17-18-16(22)11-6-2-3-7-12(11)19(23)24/h2-10H,1H3,(H,17,21)(H,18,22) |
| InChIKey | TWKNZRUCGTUPRU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|