C19H23N5O4S — CID 49448796
4-methyl-N-[1-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 49448796) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-methyl-N-[1-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[1-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 49448796 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-methyl-N-[1-[2-(N-methyl-4-nitroanilino)-2-oxoethyl]piperidin-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NC1CCN(CC(=O)N(C)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H23N5O4S/c1-13-18(29-12-20-13)19(26)21-14-7-9-23(10-8-14)11-17(25)22(2)15-3-5-16(6-4-15)24(27)28/h3-6,12,14H,7-11H2,1-2H3,(H,21,26) |
| InChIKey | IOKHPMBATNZPPC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|