C43H34N4O8 — CID 4944896
2-(2-nitrophenoxy)-N-[4-[9-[4-[2-(2-nitrophenoxy)propanoylamino]phenyl]fluoren-9-yl]phenyl]propanamide (PubChem CID 4944896) has the molecular formula C43H34N4O8 and a molecular weight of 734.76 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[4-[9-[4-[2-(2-nitrophenoxy)propanoylamino]phenyl]fluoren-9-yl]phenyl]propanamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[4-[9-[4-[2-(2-nitrophenoxy)propanoylamino]phenyl]fluoren-9-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 4944896 |
| Molecular Formula | C43H34N4O8 |
| Molecular Weight | 734.76 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[4-[9-[4-[2-(2-nitrophenoxy)propanoylamino]phenyl]fluoren-9-yl]phenyl]propanamide |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)Nc1ccc(C2(c3ccc(NC(=O)C(C)Oc4ccccc4[N+](=O)[O-])cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C43H34N4O8/c1-27(54-39-17-9-7-15-37(39)46(50)51)41(48)44-31-23-19-29(20-24-31)43(35-13-5-3-11-33(35)34-12-4-6-14-36(34)43)30-21-25-32(26-22-30)45-42(49)28(2)55-40-18-10-8-16-38(40)47(52)53/h3-28H,1-2H3,(H,44,48)(H,45,49) |
| InChIKey | OCYJUPTVDICJAC-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.76 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|