C16H12BrN3O3S — CID 4945787
N-[(2-bromo-4-nitrophenyl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 4945787) has the molecular formula C16H12BrN3O3S and a molecular weight of 406.26 g/mol. Its IUPAC name is N-[(2-bromo-4-nitrophenyl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(2-bromo-4-nitrophenyl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4945787 |
| Molecular Formula | C16H12BrN3O3S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | N-[(2-bromo-4-nitrophenyl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(=S)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C16H12BrN3O3S/c17-13-10-12(20(22)23)7-8-14(13)18-16(24)19-15(21)9-6-11-4-2-1-3-5-11/h1-10H,(H2,18,19,21,24) |
| InChIKey | MZSIBJDCJNOCKY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|