C15H20N2O4S2 — CID 49459732
N-[3-(ethylsulfonylamino)propyl]naphthalene-2-sulfonamide (PubChem CID 49459732) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[3-(ethylsulfonylamino)propyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-(ethylsulfonylamino)propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 49459732 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[3-(ethylsulfonylamino)propyl]naphthalene-2-sulfonamide |
| SMILES | CCS(=O)(=O)NCCCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H20N2O4S2/c1-2-22(18,19)16-10-5-11-17-23(20,21)15-9-8-13-6-3-4-7-14(13)12-15/h3-4,6-9,12,16-17H,2,5,10-11H2,1H3 |
| InChIKey | OZNKOBKSTIWOID-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|