About 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide
4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 49460259) has the molecular formula C11H10BrClN2O2S2
and a molecular weight of 381.70 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| PubChem CID | 49460259 |
| Molecular Formula | C11H10BrClN2O2S2 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1nccs1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H10BrClN2O2S2/c12-8-1-2-10(9(13)7-8)19(16,17)15-4-3-11-14-5-6-18-11/h1-2,5-7,15H,3-4H2 |
| InChIKey | NBGNACLPFGZEHF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide?
The IUPAC name of 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (CID 49460259) is 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
What is the SMILES notation for 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide?
The canonical SMILES for 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide is O=S(=O)(NCCc1nccs1)c1ccc(Br)cc1Cl.
What is the InChIKey of 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide?
The InChIKey is NBGNACLPFGZEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrClN2O2S2/c12-8-1-2-10(9(13)7-8)19(16,17)15-4-3-11-14-5-6-18-11/h1-2,5-7,15H,3-4H2.
What are the key properties of 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide?
4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide has a molecular weight of 381.70 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide is sourced from PubChem (CID 49460259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).