About methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate
methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 49467869) has the molecular formula C15H21N3O3S
and a molecular weight of 323.42 g/mol. Its IUPAC name is methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 49467869 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1c(C)nsc1NC(=O)N(C)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H21N3O3S/c1-8-11(14(19)21-3)13(22-17-8)16-15(20)18(2)12(9-4-5-9)10-6-7-10/h9-10,12H,4-7H2,1-3H3,(H,16,20) |
| InChIKey | BSLCGWVGUCXYAS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate (CID 49467869) is methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate is COC(=O)c1c(C)nsc1NC(=O)N(C)C(C1CC1)C1CC1.
What is the InChIKey of methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is BSLCGWVGUCXYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3S/c1-8-11(14(19)21-3)13(22-17-8)16-15(20)18(2)12(9-4-5-9)10-6-7-10/h9-10,12H,4-7H2,1-3H3,(H,16,20).
What are the key properties of methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate?
methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 323.42 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[dicyclopropylmethyl(methyl)carbamoyl]amino]-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 49467869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).