C18H26N4O3 — CID 49471723
4-N-(1-benzylpiperidin-4-yl)morpholine-2,4-dicarboxamide (PubChem CID 49471723) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-4-yl)morpholine-2,4-dicarboxamide.
| Compound Name | 4-N-(1-benzylpiperidin-4-yl)morpholine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 49471723 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-N-(1-benzylpiperidin-4-yl)morpholine-2,4-dicarboxamide |
| SMILES | NC(=O)C1CN(C(=O)NC2CCN(Cc3ccccc3)CC2)CCO1 |
| InChI | InChI=1S/C18H26N4O3/c19-17(23)16-13-22(10-11-25-16)18(24)20-15-6-8-21(9-7-15)12-14-4-2-1-3-5-14/h1-5,15-16H,6-13H2,(H2,19,23)(H,20,24) |
| InChIKey | ZAPWPUVBUDRRQR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |