C20H23Cl2NO2 — CID 4950610
N-(3,5-dichlorophenyl)-4-heptoxybenzamide (PubChem CID 4950610) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-heptoxybenzamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-heptoxybenzamide |
|---|---|
| PubChem CID | 4950610 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO2/c1-2-3-4-5-6-11-25-19-9-7-15(8-10-19)20(24)23-18-13-16(21)12-17(22)14-18/h7-10,12-14H,2-6,11H2,1H3,(H,23,24) |
| InChIKey | WAMUVEGAJBMHBY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|