C42H52N2O4 — CID 4951178
4-heptoxy-N-[4-[4-[(4-heptoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide (PubChem CID 4951178) has the molecular formula C42H52N2O4 and a molecular weight of 648.89 g/mol. Its IUPAC name is 4-heptoxy-N-[4-[4-[(4-heptoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide.
| Compound Name | 4-heptoxy-N-[4-[4-[(4-heptoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 4951178 |
| Molecular Formula | C42H52N2O4 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | 4-heptoxy-N-[4-[4-[(4-heptoxybenzoyl)amino]-3-methylphenyl]-2-methylphenyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2ccc(-c3ccc(NC(=O)c4ccc(OCCCCCCC)cc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C42H52N2O4/c1-5-7-9-11-13-27-47-37-21-15-33(16-22-37)41(45)43-39-25-19-35(29-31(39)3)36-20-26-40(32(4)30-36)44-42(46)34-17-23-38(24-18-34)48-28-14-12-10-8-6-2/h15-26,29-30H,5-14,27-28H2,1-4H3,(H,43,45)(H,44,46) |
| InChIKey | KFWXQIZTDMZOTM-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|