C19H29N3O3S — CID 4954149
N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]hexanamide (PubChem CID 4954149) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]hexanamide.
| Compound Name | N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 4954149 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)NNC(=O)COc1ccccc1C(C)CC |
| InChI | InChI=1S/C19H29N3O3S/c1-4-6-7-12-17(23)20-19(26)22-21-18(24)13-25-16-11-9-8-10-15(16)14(3)5-2/h8-11,14H,4-7,12-13H2,1-3H3,(H,21,24)(H2,20,22,23,26) |
| InChIKey | HZSBSVJVGFEPKA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|