C16H22ClN3O3S — CID 4954178
N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]hexanamide (PubChem CID 4954178) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]hexanamide.
| Compound Name | N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 4954178 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)NNC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C16H22ClN3O3S/c1-3-4-5-6-14(21)18-16(24)20-19-15(22)10-23-13-8-7-12(17)9-11(13)2/h7-9H,3-6,10H2,1-2H3,(H,19,22)(H2,18,20,21,24) |
| InChIKey | SNYQVQHYTQCBHC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|