C30H28N2O5 — CID 4954400
N-(4-ethoxyphenyl)-2-[[2-(2-phenoxyethoxy)benzoyl]amino]benzamide (PubChem CID 4954400) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[2-(2-phenoxyethoxy)benzoyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[2-(2-phenoxyethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 4954400 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[2-(2-phenoxyethoxy)benzoyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-2-35-24-18-16-22(17-19-24)31-29(33)25-12-6-8-14-27(25)32-30(34)26-13-7-9-15-28(26)37-21-20-36-23-10-4-3-5-11-23/h3-19H,2,20-21H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | WQVXYDFXBYVCQR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|