C22H26N2 — CID 49556
5H-Dibenzo(a,d)cycloheptene, 10,11-dihydro-5-(2-(4-methylpiperazinyl)ethylidene)- (PubChem CID 49556) has the molecular formula C22H26N2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-methyl-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]piperazine.
| Compound Name | 5H-Dibenzo(a,d)cycloheptene, 10,11-dihydro-5-(2-(4-methylpiperazinyl)ethylidene)- |
|---|---|
| PubChem CID | 49556 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-methyl-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]piperazine |
| SMILES | CN1CCN(CC1)CC=C2C3=CC=CC=C3CCC4=CC=CC=C42 |
| InChI | InChI=1S/C22H26N2/c1-23-14-16-24(17-15-23)13-12-22-20-8-4-2-6-18(20)10-11-19-7-3-5-9-21(19)22/h2-9,12H,10-11,13-17H2,1H3 |
| InChIKey | MUOHKHSNNJAZIW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | 409 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|