C18H18N2O4S — CID 4957681
methyl 2-[(3-ethoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 4957681) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 2-[(3-ethoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 2-[(3-ethoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4957681 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl 2-[(3-ethoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)OC)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-3-24-13-8-6-7-12(11-13)16(21)20-18(25)19-15-10-5-4-9-14(15)17(22)23-2/h4-11H,3H2,1-2H3,(H2,19,20,21,25) |
| InChIKey | WOVCQEHPCYVVRW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|