C19H22N2O4 — CID 4959294
2-(4-butan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 4959294) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-(4-butan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4959294 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | CCC(C)c1ccc(OCC(=O)Nc2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-13(2)15-6-9-17(10-7-15)25-12-19(22)20-18-11-16(21(23)24)8-5-14(18)3/h5-11,13H,4,12H2,1-3H3,(H,20,22) |
| InChIKey | HJSCKDVYNCLTCD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|